C15H17N2OP — CID 86209886
1-diphenylphosphanyl-1,3-dimethylurea (PubChem CID 86209886) has the molecular formula C15H17N2OP and a molecular weight of 272.29 g/mol. Its IUPAC name is 1-diphenylphosphanyl-1,3-dimethylurea.
| Compound Name | 1-diphenylphosphanyl-1,3-dimethylurea |
|---|---|
| PubChem CID | 86209886 |
| Molecular Formula | C15H17N2OP |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-diphenylphosphanyl-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H17N2OP/c1-16-15(18)17(2)19(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,1-2H3,(H,16,18) |
| InChIKey | XICQCIJPVMVNGB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|