C17H21N2O2P — CID 86087456
N-(3-aminopropyl)-2-diphenylphosphorylacetamide (PubChem CID 86087456) has the molecular formula C17H21N2O2P and a molecular weight of 316.34 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-diphenylphosphorylacetamide.
| Compound Name | N-(3-aminopropyl)-2-diphenylphosphorylacetamide |
|---|---|
| PubChem CID | 86087456 |
| Molecular Formula | C17H21N2O2P |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-(3-aminopropyl)-2-diphenylphosphorylacetamide |
| SMILES | NCCCNC(=O)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21N2O2P/c18-12-7-13-19-17(20)14-22(21,15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-11H,7,12-14,18H2,(H,19,20) |
| InChIKey | OPWURVZVEONYDW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|