C25H29NOP+ — CID 46933855
1-(2,2-dimethylpropanoylamino)ethyl-triphenylphosphanium (PubChem CID 46933855) has the molecular formula C25H29NOP+ and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoylamino)ethyl-triphenylphosphanium.
| Compound Name | 1-(2,2-dimethylpropanoylamino)ethyl-triphenylphosphanium |
|---|---|
| PubChem CID | 46933855 |
| Molecular Formula | C25H29NOP+ |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 1-(2,2-dimethylpropanoylamino)ethyl-triphenylphosphanium |
| SMILES | CC(NC(=O)C(C)(C)C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28NOP/c1-20(26-24(27)25(2,3)4)28(21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20H,1-4H3/p+1 |
| InChIKey | UKPJMNUASDJSTP-UHFFFAOYSA-O |
| XLogP | 4.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|