C26H28BrF3NOP — CID 164677143
N-[(2S,3S)-1-[bromo(triphenyl)-λ5-phosphanyl]-3-methylpentan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 164677143) has the molecular formula C26H28BrF3NOP and a molecular weight of 538.39 g/mol. Its IUPAC name is N-[(2S,3S)-1-[bromo(triphenyl)-λ5-phosphanyl]-3-methylpentan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3S)-1-[bromo(triphenyl)-λ5-phosphanyl]-3-methylpentan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 164677143 |
| Molecular Formula | C26H28BrF3NOP |
| Molecular Weight | 538.39 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | N-[(2S,3S)-1-[bromo(triphenyl)-λ5-phosphanyl]-3-methylpentan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC[C@H](C)[C@@H](CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C26H28BrF3NOP/c1-3-20(2)24(31-25(32)26(28,29)30)19-33(27,21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,20,24H,3,19H2,1-2H3,(H,31,32)/t20-,24+/m0/s1 |
| InChIKey | QLIHKEZXFKRKMB-GBXCKJPGSA-N |
| XLogP | 5.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.39 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|