C27H31BrNOP — CID 134977833
3-[bromo(triphenyl)-λ5-phosphanyl]-N-cyclohexylpropanamide (PubChem CID 134977833) has the molecular formula C27H31BrNOP and a molecular weight of 496.43 g/mol. Its IUPAC name is 3-[bromo(triphenyl)-λ5-phosphanyl]-N-cyclohexylpropanamide.
| Compound Name | 3-[bromo(triphenyl)-λ5-phosphanyl]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 134977833 |
| Molecular Formula | C27H31BrNOP |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 3-[bromo(triphenyl)-λ5-phosphanyl]-N-cyclohexylpropanamide |
| SMILES | O=C(CCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C27H31BrNOP/c28-31(24-15-7-2-8-16-24,25-17-9-3-10-18-25,26-19-11-4-12-20-26)22-21-27(30)29-23-13-5-1-6-14-23/h2-4,7-12,15-20,23H,1,5-6,13-14,21-22H2,(H,29,30) |
| InChIKey | LHIZAZZFVWAYIU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|