C27H26F2NO2P — CID 172615411
N-(4,4-difluorocyclohexyl)-2-oxo-3-(triphenyl-λ5-phosphanylidene)propanamide (PubChem CID 172615411) has the molecular formula C27H26F2NO2P and a molecular weight of 465.48 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2-oxo-3-(triphenyl-λ5-phosphanylidene)propanamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-2-oxo-3-(triphenyl-λ5-phosphanylidene)propanamide |
|---|---|
| PubChem CID | 172615411 |
| Molecular Formula | C27H26F2NO2P |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2-oxo-3-(triphenyl-λ5-phosphanylidene)propanamide |
| SMILES | O=C(C=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C27H26F2NO2P/c28-27(29)18-16-21(17-19-27)30-26(32)25(31)20-33(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15,20-21H,16-19H2,(H,30,32) |
| InChIKey | VVFXTXYFSFABAP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|