C27H25F5NO2P — CID 2752546
N-butyl-4,4,5,5,5-pentafluoro-3-oxo-2-(triphenyl-lambda5-phosphanylidene)pentanamide (PubChem CID 2752546) has the molecular formula C27H25F5NO2P and a molecular weight of 521.47 g/mol. Its IUPAC name is N-butyl-4,4,5,5,5-pentafluoro-3-oxo-2-(triphenyl-lambda5-phosphanylidene)pentanamide.
| Compound Name | N-butyl-4,4,5,5,5-pentafluoro-3-oxo-2-(triphenyl-lambda5-phosphanylidene)pentanamide |
|---|---|
| PubChem CID | 2752546 |
| Molecular Formula | C27H25F5NO2P |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | N-butyl-4,4,5,5,5-pentafluoro-3-oxo-2-(triphenyl-lambda5-phosphanylidene)pentanamide |
| SMILES | CCCCNC(=O)C(C(=O)C(F)(F)C(F)(F)F)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25F5NO2P/c1-2-3-19-33-25(35)23(24(34)26(28,29)27(30,31)32)36(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18H,2-3,19H2,1H3,(H,33,35) |
| InChIKey | JUHUHGRMENIWQJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|