About 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide
5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide (PubChem CID 90049954) has the molecular formula C25H29BrNOP
and a molecular weight of 470.39 g/mol. Its IUPAC name is 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide.
Molecular Properties
| Compound Name | 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide |
| PubChem CID | 90049954 |
| Molecular Formula | C25H29BrNOP |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide |
| SMILES | CCNC(=O)CCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29BrNOP/c1-2-27-25(28)20-12-13-21-29(26,22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24/h3-11,14-19H,2,12-13,20-21H2,1H3,(H,27,28) |
| InChIKey | YKABPDFFGOSWHO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide?
The IUPAC name of 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide (CID 90049954) is 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide.
What is the SMILES notation for 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide?
The canonical SMILES for 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide is CCNC(=O)CCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide?
The InChIKey is YKABPDFFGOSWHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29BrNOP/c1-2-27-25(28)20-12-13-21-29(26,22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24/h3-11,14-19H,2,12-13,20-21H2,1H3,(H,27,28).
What are the key properties of 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide?
5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide has a molecular weight of 470.39 g/mol, XLogP of 5.13, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide is sourced from PubChem (CID 90049954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).