C25H29BrNOP — CID 90049954
5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide (PubChem CID 90049954) has the molecular formula C25H29BrNOP and a molecular weight of 470.39 g/mol. Its IUPAC name is 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide.
| Compound Name | 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide |
|---|---|
| PubChem CID | 90049954 |
| Molecular Formula | C25H29BrNOP |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 5-[bromo(triphenyl)-λ5-phosphanyl]-N-ethylpentanamide |
| SMILES | CCNC(=O)CCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29BrNOP/c1-2-27-25(28)20-12-13-21-29(26,22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24/h3-11,14-19H,2,12-13,20-21H2,1H3,(H,27,28) |
| InChIKey | YKABPDFFGOSWHO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|