C21H21ClNOP — CID 134977828
2-[chloro(triphenyl)-λ5-phosphanyl]-N-methylacetamide (PubChem CID 134977828) has the molecular formula C21H21ClNOP and a molecular weight of 369.83 g/mol. Its IUPAC name is 2-[chloro(triphenyl)-λ5-phosphanyl]-N-methylacetamide.
| Compound Name | 2-[chloro(triphenyl)-λ5-phosphanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 134977828 |
| Molecular Formula | C21H21ClNOP |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[chloro(triphenyl)-λ5-phosphanyl]-N-methylacetamide |
| SMILES | CNC(=O)CP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21ClNOP/c1-23-21(24)17-25(22,18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,17H2,1H3,(H,23,24) |
| InChIKey | QVAJXOIDUNRKNP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|