C21H18Cl4NOP — CID 45048470
triphenyl-[[(2,2,2-trichloroacetyl)amino]methyl]phosphanium chloride (PubChem CID 45048470) has the molecular formula C21H18Cl4NOP and a molecular weight of 473.17 g/mol. Its IUPAC name is triphenyl-[[(2,2,2-trichloroacetyl)amino]methyl]phosphanium chloride.
| Compound Name | triphenyl-[[(2,2,2-trichloroacetyl)amino]methyl]phosphanium chloride |
|---|---|
| PubChem CID | 45048470 |
| Molecular Formula | C21H18Cl4NOP |
| Molecular Weight | 473.17 g/mol |
| Exact Mass | 470.99 |
| IUPAC Name | triphenyl-[[(2,2,2-trichloroacetyl)amino]methyl]phosphanium chloride |
| SMILES | O=C(NC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(Cl)(Cl)Cl.[Cl-] |
| InChI | InChI=1S/C21H17Cl3NOP.ClH/c22-21(23,24)20(26)25-16-27(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;/h1-15H,16H2;1H |
| InChIKey | DYNQMUPLSDSTOG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|