C21H18ClF3NOP — CID 140527057
N-[[chloro(triphenyl)-λ5-phosphanyl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 140527057) has the molecular formula C21H18ClF3NOP and a molecular weight of 423.80 g/mol. Its IUPAC name is N-[[chloro(triphenyl)-λ5-phosphanyl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[chloro(triphenyl)-λ5-phosphanyl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 140527057 |
| Molecular Formula | C21H18ClF3NOP |
| Molecular Weight | 423.80 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-[[chloro(triphenyl)-λ5-phosphanyl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H18ClF3NOP/c22-28(17-10-4-1-5-11-17,18-12-6-2-7-13-18,19-14-8-3-9-15-19)16-26-20(27)21(23,24)25/h1-15H,16H2,(H,26,27) |
| InChIKey | WGUFBUBPTPNTRV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.80 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|