C24H27NOP+ — CID 4061676
(2,2-dimethylpropanoylamino)methyl-triphenylphosphanium (PubChem CID 4061676) has the molecular formula C24H27NOP+ and a molecular weight of 376.46 g/mol. Its IUPAC name is (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium.
| Compound Name | (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 4061676 |
| Molecular Formula | C24H27NOP+ |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium |
| SMILES | CC(C)(C)C(=O)NC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26NOP/c1-24(2,3)23(26)25-19-27(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18H,19H2,1-3H3/p+1 |
| InChIKey | WVCBJRFHIFETEQ-UHFFFAOYSA-O |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|