C17H16F2NOP — CID 76530787
6-bis(4-fluorophenyl)phosphanylpiperidin-2-one (PubChem CID 76530787) has the molecular formula C17H16F2NOP and a molecular weight of 319.29 g/mol. Its IUPAC name is 6-bis(4-fluorophenyl)phosphanylpiperidin-2-one.
| Compound Name | 6-bis(4-fluorophenyl)phosphanylpiperidin-2-one |
|---|---|
| PubChem CID | 76530787 |
| Molecular Formula | C17H16F2NOP |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 6-bis(4-fluorophenyl)phosphanylpiperidin-2-one |
| SMILES | O=C1CCCC(P(c2ccc(F)cc2)c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C17H16F2NOP/c18-12-4-8-14(9-5-12)22(15-10-6-13(19)7-11-15)17-3-1-2-16(21)20-17/h4-11,17H,1-3H2,(H,20,21) |
| InChIKey | GAYZXWZVDYSXKM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|