C25H24F3NOP+ — CID 22403608
[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-triphenylphosphanium (PubChem CID 22403608) has the molecular formula C25H24F3NOP+ and a molecular weight of 442.44 g/mol. Its IUPAC name is [2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-triphenylphosphanium.
| Compound Name | [2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 22403608 |
| Molecular Formula | C25H24F3NOP+ |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-triphenylphosphanium |
| SMILES | O=C1C([P+](c2ccccc2)(c2ccccc2)c2ccccc2)CCCN1CC(F)(F)F |
| InChI | InChI=1S/C25H24F3NOP/c26-25(27,28)19-29-18-10-17-23(24(29)30)31(20-11-4-1-5-12-20,21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23H,10,17-19H2/q+1 |
| InChIKey | QEFDIAWGELQXKH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|