C24H22F3NOP+ — CID 10505811
[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium (PubChem CID 10505811) has the molecular formula C24H22F3NOP+ and a molecular weight of 428.41 g/mol. Its IUPAC name is [2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium.
| Compound Name | [2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 10505811 |
| Molecular Formula | C24H22F3NOP+ |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium |
| SMILES | O=C1C([P+](c2ccccc2)(c2ccccc2)c2ccccc2)CCN1CC(F)(F)F |
| InChI | InChI=1S/C24H22F3NOP/c25-24(26,27)18-28-17-16-22(23(28)29)30(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,22H,16-18H2/q+1 |
| InChIKey | OSPTZGRNOAMTSS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|