C19H19F3NOP — CID 15446209
1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 15446209) has the molecular formula C19H19F3NOP and a molecular weight of 365.33 g/mol. Its IUPAC name is 1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 15446209 |
| Molecular Formula | C19H19F3NOP |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCC[C@H]1CP(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H19F3NOP/c20-19(21,22)18(24)23-13-7-8-15(23)14-25(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-6,9-12,15H,7-8,13-14H2/t15-/m0/s1 |
| InChIKey | GZDQJZQXKGTFCX-HNNXBMFYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|