C20H25N2OP — CID 11121360
(2S)-2-(diphenylphosphanylmethyl)-N,N-dimethylpyrrolidine-1-carboxamide (PubChem CID 11121360) has the molecular formula C20H25N2OP and a molecular weight of 340.41 g/mol. Its IUPAC name is (2S)-2-(diphenylphosphanylmethyl)-N,N-dimethylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-(diphenylphosphanylmethyl)-N,N-dimethylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 11121360 |
| Molecular Formula | C20H25N2OP |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (2S)-2-(diphenylphosphanylmethyl)-N,N-dimethylpyrrolidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25N2OP/c1-21(2)20(23)22-15-9-10-17(22)16-24(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-14,17H,9-10,15-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | UNUWJFXTGCUXPZ-KRWDZBQOSA-N |
| XLogP | 3.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|