C19H23N2O2P — CID 139600058
2-diphenylphosphoryl-N,N-dimethylpyrrolidine-1-carboxamide (PubChem CID 139600058) has the molecular formula C19H23N2O2P and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-diphenylphosphoryl-N,N-dimethylpyrrolidine-1-carboxamide.
| Compound Name | 2-diphenylphosphoryl-N,N-dimethylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 139600058 |
| Molecular Formula | C19H23N2O2P |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-diphenylphosphoryl-N,N-dimethylpyrrolidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCCC1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23N2O2P/c1-20(2)19(22)21-15-9-14-18(21)24(23,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13,18H,9,14-15H2,1-2H3 |
| InChIKey | GBPJJQIYOVNZJA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|