C17H19N2O2P — CID 139600015
2-diphenylphosphorylpyrrolidine-1-carboxamide (PubChem CID 139600015) has the molecular formula C17H19N2O2P and a molecular weight of 314.32 g/mol. Its IUPAC name is 2-diphenylphosphorylpyrrolidine-1-carboxamide.
| Compound Name | 2-diphenylphosphorylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 139600015 |
| Molecular Formula | C17H19N2O2P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-diphenylphosphorylpyrrolidine-1-carboxamide |
| SMILES | NC(=O)N1CCCC1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19N2O2P/c18-17(20)19-13-7-12-16(19)22(21,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13H2,(H2,18,20) |
| InChIKey | MENKULTZKWAAPW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|