C20H24N3O3P — CID 155920022
1-diphenylphosphoryl-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea (PubChem CID 155920022) has the molecular formula C20H24N3O3P and a molecular weight of 385.40 g/mol. Its IUPAC name is 1-diphenylphosphoryl-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea.
| Compound Name | 1-diphenylphosphoryl-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 155920022 |
| Molecular Formula | C20H24N3O3P |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-diphenylphosphoryl-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea |
| SMILES | O=C(NCCCN1CCCC1=O)NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N3O3P/c24-19-13-7-15-23(19)16-8-14-21-20(25)22-27(26,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2,(H2,21,22,25,26) |
| InChIKey | QBZFYLNYDMZMTE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|