C21H29N2O2P — CID 154585283
N-[3-(diethylamino)propyl]-2-diphenylphosphorylacetamide (PubChem CID 154585283) has the molecular formula C21H29N2O2P and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-diphenylphosphorylacetamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-diphenylphosphorylacetamide |
|---|---|
| PubChem CID | 154585283 |
| Molecular Formula | C21H29N2O2P |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-diphenylphosphorylacetamide |
| SMILES | CCN(CC)CCCNC(=O)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29N2O2P/c1-3-23(4-2)17-11-16-22-21(24)18-26(25,19-12-7-5-8-13-19)20-14-9-6-10-15-20/h5-10,12-15H,3-4,11,16-18H2,1-2H3,(H,22,24) |
| InChIKey | QKMKMHBHDYYLKI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|