C22H30NOP — CID 15769528
N,N-dibutyl-2-diphenylphosphanylacetamide (PubChem CID 15769528) has the molecular formula C22H30NOP and a molecular weight of 355.46 g/mol. Its IUPAC name is N,N-dibutyl-2-diphenylphosphanylacetamide.
| Compound Name | N,N-dibutyl-2-diphenylphosphanylacetamide |
|---|---|
| PubChem CID | 15769528 |
| Molecular Formula | C22H30NOP |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N,N-dibutyl-2-diphenylphosphanylacetamide |
| SMILES | CCCCN(CCCC)C(=O)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30NOP/c1-3-5-17-23(18-6-4-2)22(24)19-25(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16H,3-6,17-19H2,1-2H3 |
| InChIKey | OXZOHKPLLAMTMB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|