C24H32NOP — CID 11025347
1-[(2S)-2-(diphenylphosphanylmethyl)-4,4-dimethylpyrrolidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 11025347) has the molecular formula C24H32NOP and a molecular weight of 381.50 g/mol. Its IUPAC name is 1-[(2S)-2-(diphenylphosphanylmethyl)-4,4-dimethylpyrrolidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(2S)-2-(diphenylphosphanylmethyl)-4,4-dimethylpyrrolidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 11025347 |
| Molecular Formula | C24H32NOP |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-[(2S)-2-(diphenylphosphanylmethyl)-4,4-dimethylpyrrolidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC1(C)C[C@@H](CP(c2ccccc2)c2ccccc2)N(C(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H32NOP/c1-23(2,3)22(26)25-18-24(4,5)16-19(25)17-27(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,19H,16-18H2,1-5H3/t19-/m0/s1 |
| InChIKey | PVLZVMHIWIJCHH-IBGZPJMESA-N |
| XLogP | 4.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|