C23H30NO2P — CID 102475093
cis-(1R,2S)-2-diphenylphosphoryl-1-methyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide (PubChem CID 102475093) has the molecular formula C23H30NO2P and a molecular weight of 383.47 g/mol. Its IUPAC name is cis-(1R,2S)-2-diphenylphosphoryl-1-methyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-diphenylphosphoryl-1-methyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 102475093 |
| Molecular Formula | C23H30NO2P |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | cis-(1R,2S)-2-diphenylphosphoryl-1-methyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide |
| SMILES | CC(C)N(C(=O)[C@@]1(C)C[C@@H]1P(=O)(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C23H30NO2P/c1-17(2)24(18(3)4)22(25)23(5)16-21(23)27(26,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,17-18,21H,16H2,1-5H3/t21-,23-/m0/s1 |
| InChIKey | FKYCAFLDROZISH-GMAHTHKFSA-N |
| XLogP | 4.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|