C19H22NOP — CID 15416363
(5S)-5-(diphenylphosphanylmethyl)-3,3-dimethylpyrrolidin-2-one (PubChem CID 15416363) has the molecular formula C19H22NOP and a molecular weight of 311.37 g/mol. Its IUPAC name is (5S)-5-(diphenylphosphanylmethyl)-3,3-dimethylpyrrolidin-2-one.
| Compound Name | (5S)-5-(diphenylphosphanylmethyl)-3,3-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 15416363 |
| Molecular Formula | C19H22NOP |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (5S)-5-(diphenylphosphanylmethyl)-3,3-dimethylpyrrolidin-2-one |
| SMILES | CC1(C)C[C@@H](CP(c2ccccc2)c2ccccc2)NC1=O |
| InChI | InChI=1S/C19H22NOP/c1-19(2)13-15(20-18(19)21)14-22(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | VMXVGIJGZNZGBL-HNNXBMFYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|