C19H21LiNOP — CID 134991643
lithium 5-(diphenylphosphanylmethyl)-3,3-dimethylpyrrolidin-1-id-2-one (PubChem CID 134991643) has the molecular formula C19H21LiNOP and a molecular weight of 317.30 g/mol. Its IUPAC name is lithium 5-(diphenylphosphanylmethyl)-3,3-dimethylpyrrolidin-1-id-2-one.
| Compound Name | lithium 5-(diphenylphosphanylmethyl)-3,3-dimethylpyrrolidin-1-id-2-one |
|---|---|
| PubChem CID | 134991643 |
| Molecular Formula | C19H21LiNOP |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | lithium 5-(diphenylphosphanylmethyl)-3,3-dimethylpyrrolidin-1-id-2-one |
| SMILES | CC1(C)CC(CP(c2ccccc2)c2ccccc2)[N-]C1=O.[Li+] |
| InChI | InChI=1S/C19H22NOP.Li/c1-19(2)13-15(20-18(19)21)14-22(16-9-5-3-6-10-16)17-11-7-4-8-12-17;/h3-12,15H,13-14H2,1-2H3,(H,20,21);/q;+1/p-1 |
| InChIKey | MECANQSHQOHZOO-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|