C24H32NOP — CID 58921855
(2R)-2-diphenylphosphanyl-N,N-di(propan-2-yl)cyclopentane-1-carboxamide (PubChem CID 58921855) has the molecular formula C24H32NOP and a molecular weight of 381.50 g/mol. Its IUPAC name is (2R)-2-diphenylphosphanyl-N,N-di(propan-2-yl)cyclopentane-1-carboxamide.
| Compound Name | (2R)-2-diphenylphosphanyl-N,N-di(propan-2-yl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 58921855 |
| Molecular Formula | C24H32NOP |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | (2R)-2-diphenylphosphanyl-N,N-di(propan-2-yl)cyclopentane-1-carboxamide |
| SMILES | CC(C)N(C(=O)C1CCC[C@H]1P(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C24H32NOP/c1-18(2)25(19(3)4)24(26)22-16-11-17-23(22)27(20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-10,12-15,18-19,22-23H,11,16-17H2,1-4H3/t22?,23-/m1/s1 |
| InChIKey | BYILKEJUGHMSLQ-OZAIVSQSSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|