C24H30NOP — CID 11337957
1-[(1S,3R,4R)-3-(diphenylphosphanylmethyl)-2-azabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 11337957) has the molecular formula C24H30NOP and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-[(1S,3R,4R)-3-(diphenylphosphanylmethyl)-2-azabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(1S,3R,4R)-3-(diphenylphosphanylmethyl)-2-azabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 11337957 |
| Molecular Formula | C24H30NOP |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[(1S,3R,4R)-3-(diphenylphosphanylmethyl)-2-azabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1[C@H]2CC[C@H](C2)[C@@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30NOP/c1-24(2,3)23(26)25-19-15-14-18(16-19)22(25)17-27(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,18-19,22H,14-17H2,1-3H3/t18-,19+,22+/m1/s1 |
| InChIKey | AHWSDSJALWHKDP-DXIQSLLYSA-N |
| XLogP | 4.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|