C14H19NOSe — CID 15507886
1,3,3-trimethyl-5-(phenylselanylmethyl)pyrrolidin-2-one (PubChem CID 15507886) has the molecular formula C14H19NOSe and a molecular weight of 296.27 g/mol. Its IUPAC name is 1,3,3-trimethyl-5-(phenylselanylmethyl)pyrrolidin-2-one.
| Compound Name | 1,3,3-trimethyl-5-(phenylselanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 15507886 |
| Molecular Formula | C14H19NOSe |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 1,3,3-trimethyl-5-(phenylselanylmethyl)pyrrolidin-2-one |
| SMILES | CN1C(=O)C(C)(C)CC1C[Se]c1ccccc1 |
| InChI | InChI=1S/C14H19NOSe/c1-14(2)9-11(15(3)13(14)16)10-17-12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3 |
| InChIKey | VYQNWUALRBOUCQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|