C23H33INOP — CID 164678425
N-[(2S)-1-(iodo-methyl-diphenyl-λ5-phosphanyl)-3-methylbutan-2-yl]-2,2-dimethylpropanamide (PubChem CID 164678425) has the molecular formula C23H33INOP and a molecular weight of 497.40 g/mol. Its IUPAC name is N-[(2S)-1-(iodo-methyl-diphenyl-λ5-phosphanyl)-3-methylbutan-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(2S)-1-(iodo-methyl-diphenyl-λ5-phosphanyl)-3-methylbutan-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 164678425 |
| Molecular Formula | C23H33INOP |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | N-[(2S)-1-(iodo-methyl-diphenyl-λ5-phosphanyl)-3-methylbutan-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)[C@@H](CP(C)(I)(c1ccccc1)c1ccccc1)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H33INOP/c1-18(2)21(25-22(26)23(3,4)5)17-27(6,24,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21H,17H2,1-6H3,(H,25,26)/t21-/m1/s1 |
| InChIKey | GWBVLUZPZJONIR-OAQYLSRUSA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|