C19H21NO — CID 101393401
1-(2-methyl-4,4-diphenylpyrrolidin-1-yl)ethanone (PubChem CID 101393401) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(2-methyl-4,4-diphenylpyrrolidin-1-yl)ethanone.
| Compound Name | 1-(2-methyl-4,4-diphenylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 101393401 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-(2-methyl-4,4-diphenylpyrrolidin-1-yl)ethanone |
| SMILES | CC(=O)N1CC(c2ccccc2)(c2ccccc2)CC1C |
| InChI | InChI=1S/C19H21NO/c1-15-13-19(14-20(15)16(2)21,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | RBDPKOFJFRSYRK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |