C25H24BrF3NOP — CID 139787048
3-[bromo(triphenyl)-λ5-phosphanyl]-1-(2,2,2-trifluoroethyl)piperidin-2-one (PubChem CID 139787048) has the molecular formula C25H24BrF3NOP and a molecular weight of 522.35 g/mol. Its IUPAC name is 3-[bromo(triphenyl)-λ5-phosphanyl]-1-(2,2,2-trifluoroethyl)piperidin-2-one.
| Compound Name | 3-[bromo(triphenyl)-λ5-phosphanyl]-1-(2,2,2-trifluoroethyl)piperidin-2-one |
|---|---|
| PubChem CID | 139787048 |
| Molecular Formula | C25H24BrF3NOP |
| Molecular Weight | 522.35 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 3-[bromo(triphenyl)-λ5-phosphanyl]-1-(2,2,2-trifluoroethyl)piperidin-2-one |
| SMILES | O=C1C(P(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)CCCN1CC(F)(F)F |
| InChI | InChI=1S/C25H24BrF3NOP/c26-32(20-11-4-1-5-12-20,21-13-6-2-7-14-21,22-15-8-3-9-16-22)23-17-10-18-30(24(23)31)19-25(27,28)29/h1-9,11-16,23H,10,17-19H2 |
| InChIKey | WFJMTJWDTJIPBV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.35 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|