C29H32F3NOP+ — CID 102518800
triphenyl-[(Z)-8-[(2,2,2-trifluoroacetyl)amino]non-3-enyl]phosphanium (PubChem CID 102518800) has the molecular formula C29H32F3NOP+ and a molecular weight of 498.55 g/mol. Its IUPAC name is triphenyl-[(Z)-8-[(2,2,2-trifluoroacetyl)amino]non-3-enyl]phosphanium.
| Compound Name | triphenyl-[(Z)-8-[(2,2,2-trifluoroacetyl)amino]non-3-enyl]phosphanium |
|---|---|
| PubChem CID | 102518800 |
| Molecular Formula | C29H32F3NOP+ |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | triphenyl-[(Z)-8-[(2,2,2-trifluoroacetyl)amino]non-3-enyl]phosphanium |
| SMILES | CC(CCC/C=C\CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C29H31F3NOP/c1-24(33-28(34)29(30,31)32)16-8-3-2-4-15-23-35(25-17-9-5-10-18-25,26-19-11-6-12-20-26)27-21-13-7-14-22-27/h2,4-7,9-14,17-22,24H,3,8,15-16,23H2,1H3/p+1/b4-2- |
| InChIKey | RGLXGLONCFFIPP-RQOWECAXSA-O |
| XLogP | 6.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|