C23H21F3NOP — CID 132819492
N-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 132819492) has the molecular formula C23H21F3NOP and a molecular weight of 415.40 g/mol. Its IUPAC name is N-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 132819492 |
| Molecular Formula | C23H21F3NOP |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)CP(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H21F3NOP/c24-23(25,26)22(28)27-19(16-18-10-4-1-5-11-18)17-29(20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,19H,16-17H2,(H,27,28)/t19-/m0/s1 |
| InChIKey | RBPKZHNRFCLWHZ-IBGZPJMESA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|