C23H22F3NOP+ — CID 23657253
triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium (PubChem CID 23657253) has the molecular formula C23H22F3NOP+ and a molecular weight of 416.40 g/mol. Its IUPAC name is triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium.
| Compound Name | triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium |
|---|---|
| PubChem CID | 23657253 |
| Molecular Formula | C23H22F3NOP+ |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium |
| SMILES | C[C@@H](C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C23H21F3NOP/c1-18(27-22(28)23(24,25)26)17-29(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,18H,17H2,1H3/p+1/t18-/m0/s1 |
| InChIKey | QGENBPOBKYRTQC-SFHVURJKSA-O |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|