C25H29BF4NOP — CID 164673134
1-(2,2-dimethylpropanoylamino)ethyl-triphenylphosphanium tetrafluoroborate (PubChem CID 164673134) has the molecular formula C25H29BF4NOP and a molecular weight of 477.29 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoylamino)ethyl-triphenylphosphanium tetrafluoroborate.
| Compound Name | 1-(2,2-dimethylpropanoylamino)ethyl-triphenylphosphanium tetrafluoroborate |
|---|---|
| PubChem CID | 164673134 |
| Molecular Formula | C25H29BF4NOP |
| Molecular Weight | 477.29 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 1-(2,2-dimethylpropanoylamino)ethyl-triphenylphosphanium tetrafluoroborate |
| SMILES | CC(NC(=O)C(C)(C)C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C25H28NOP.BF4/c1-20(26-24(27)25(2,3)4)28(21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23;2-1(3,4)5/h5-20H,1-4H3;/q;-1/p+1 |
| InChIKey | DLNFCDNYNQTCOX-UHFFFAOYSA-O |
| XLogP | 5.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.29 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|