C30H39N3O3P+ — CID 174198236
10-(hydroxycarbamoylcarbamoylamino)decyl-triphenylphosphanium (PubChem CID 174198236) has the molecular formula C30H39N3O3P+ and a molecular weight of 520.63 g/mol. Its IUPAC name is 10-(hydroxycarbamoylcarbamoylamino)decyl-triphenylphosphanium.
| Compound Name | 10-(hydroxycarbamoylcarbamoylamino)decyl-triphenylphosphanium |
|---|---|
| PubChem CID | 174198236 |
| Molecular Formula | C30H39N3O3P+ |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 10-(hydroxycarbamoylcarbamoylamino)decyl-triphenylphosphanium |
| SMILES | O=C(NO)NC(=O)NCCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H38N3O3P/c34-29(32-30(35)33-36)31-24-16-5-3-1-2-4-6-17-25-37(26-18-10-7-11-19-26,27-20-12-8-13-21-27)28-22-14-9-15-23-28/h7-15,18-23H,1-6,16-17,24-25H2,(H3-,31,32,33,34,35,36)/p+1 |
| InChIKey | MBBRBAOEZFQOKL-UHFFFAOYSA-O |
| XLogP | 5.50 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|