C29H37BrNO2P — CID 142458604
10-[bromo(triphenyl)-λ5-phosphanyl]decylcarbamic acid (PubChem CID 142458604) has the molecular formula C29H37BrNO2P and a molecular weight of 542.50 g/mol. Its IUPAC name is 10-[bromo(triphenyl)-λ5-phosphanyl]decylcarbamic acid.
| Compound Name | 10-[bromo(triphenyl)-λ5-phosphanyl]decylcarbamic acid |
|---|---|
| PubChem CID | 142458604 |
| Molecular Formula | C29H37BrNO2P |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 10-[bromo(triphenyl)-λ5-phosphanyl]decylcarbamic acid |
| SMILES | O=C(O)NCCCCCCCCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H37BrNO2P/c30-34(26-18-10-7-11-19-26,27-20-12-8-13-21-27,28-22-14-9-15-23-28)25-17-6-4-2-1-3-5-16-24-31-29(32)33/h7-15,18-23,31H,1-6,16-17,24-25H2,(H,32,33) |
| InChIKey | IBZKUPBLWRWECG-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|