C27H29F3NO4P — CID 142458590
6-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]hexylcarbamic acid (PubChem CID 142458590) has the molecular formula C27H29F3NO4P and a molecular weight of 519.50 g/mol. Its IUPAC name is 6-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]hexylcarbamic acid.
| Compound Name | 6-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]hexylcarbamic acid |
|---|---|
| PubChem CID | 142458590 |
| Molecular Formula | C27H29F3NO4P |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 6-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]hexylcarbamic acid |
| SMILES | O=C(O)NCCCCCCP(OC(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29F3NO4P/c28-27(29,30)25(32)35-36(22-14-6-3-7-15-22,23-16-8-4-9-17-23,24-18-10-5-11-19-24)21-13-2-1-12-20-31-26(33)34/h3-11,14-19,31H,1-2,12-13,20-21H2,(H,33,34) |
| InChIKey | PHFACBIVTFIPIJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|