C26H30BrF3NO2P — CID 156874555
6-[bromo(triphenyl)-λ5-phosphanyl]hexylazanium;2,2,2-trifluoroacetate (PubChem CID 156874555) has the molecular formula C26H30BrF3NO2P and a molecular weight of 556.40 g/mol. Its IUPAC name is 6-[bromo(triphenyl)-λ5-phosphanyl]hexylazanium;2,2,2-trifluoroacetate.
| Compound Name | 6-[bromo(triphenyl)-λ5-phosphanyl]hexylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 156874555 |
| Molecular Formula | C26H30BrF3NO2P |
| Molecular Weight | 556.40 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 6-[bromo(triphenyl)-λ5-phosphanyl]hexylazanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[NH3+]CCCCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29BrNP.C2HF3O2/c25-27(21-13-2-1-12-20-26,22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24;3-2(4,5)1(6)7/h3-11,14-19H,1-2,12-13,20-21,26H2;(H,6,7) |
| InChIKey | YNPXMCPHNDEIOL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|