C21H27NO2P+ — CID 101141188
(cyclohexylamino)-(2-methoxy-2-oxoethyl)-diphenylphosphanium (PubChem CID 101141188) has the molecular formula C21H27NO2P+ and a molecular weight of 356.43 g/mol. Its IUPAC name is (cyclohexylamino)-(2-methoxy-2-oxoethyl)-diphenylphosphanium.
| Compound Name | (cyclohexylamino)-(2-methoxy-2-oxoethyl)-diphenylphosphanium |
|---|---|
| PubChem CID | 101141188 |
| Molecular Formula | C21H27NO2P+ |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (cyclohexylamino)-(2-methoxy-2-oxoethyl)-diphenylphosphanium |
| SMILES | COC(=O)C[P+](NC1CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO2P/c1-24-21(23)17-25(19-13-7-3-8-14-19,20-15-9-4-10-16-20)22-18-11-5-2-6-12-18/h3-4,7-10,13-16,18,22H,2,5-6,11-12,17H2,1H3/q+1 |
| InChIKey | BVYKLRGAHSXMDC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|