C20H29N2O2PSn — CID 135064190
methyl N-[phenyl-(propan-2-ylamino)-(2-trimethylstannylphenyl)-λ5-phosphanylidene]carbamate (PubChem CID 135064190) has the molecular formula C20H29N2O2PSn and a molecular weight of 479.15 g/mol. Its IUPAC name is methyl N-[phenyl-(propan-2-ylamino)-(2-trimethylstannylphenyl)-λ5-phosphanylidene]carbamate.
| Compound Name | methyl N-[phenyl-(propan-2-ylamino)-(2-trimethylstannylphenyl)-λ5-phosphanylidene]carbamate |
|---|---|
| PubChem CID | 135064190 |
| Molecular Formula | C20H29N2O2PSn |
| Molecular Weight | 479.15 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | methyl N-[phenyl-(propan-2-ylamino)-(2-trimethylstannylphenyl)-λ5-phosphanylidene]carbamate |
| SMILES | COC(=O)N=P(NC(C)C)(c1ccccc1)c1ccccc1[Sn](C)(C)C |
| InChI | InChI=1S/C17H20N2O2P.3CH3.Sn/c1-14(2)18-22(19-17(20)21-3,15-10-6-4-7-11-15)16-12-8-5-9-13-16;;;;/h4-12,14,18H,1-3H3;3*1H3; |
| InChIKey | GYQHHHUNUSNYAQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|