About methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate
methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate (PubChem CID 135065000) has the molecular formula C17H20IN2O2P
and a molecular weight of 442.24 g/mol. Its IUPAC name is methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate.
Molecular Properties
| Compound Name | methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate |
| PubChem CID | 135065000 |
| Molecular Formula | C17H20IN2O2P |
| Molecular Weight | 442.24 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate |
| SMILES | COC(=O)N=P(NC(C)C)(c1ccccc1)c1ccccc1I |
| InChI | InChI=1S/C17H20IN2O2P/c1-13(2)19-23(20-17(21)22-3,14-9-5-4-6-10-14)16-12-8-7-11-15(16)18/h4-13,19H,1-3H3 |
| InChIKey | JAHLVDZICFJAEA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate?
The IUPAC name of methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate (CID 135065000) is methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate.
What is the SMILES notation for methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate?
The canonical SMILES for methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate is COC(=O)N=P(NC(C)C)(c1ccccc1)c1ccccc1I.
What is the InChIKey of methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate?
The InChIKey is JAHLVDZICFJAEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20IN2O2P/c1-13(2)19-23(20-17(21)22-3,14-9-5-4-6-10-14)16-12-8-7-11-15(16)18/h4-13,19H,1-3H3.
What are the key properties of methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate?
methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate has a molecular weight of 442.24 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2-iodophenyl)-phenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate is sourced from PubChem (CID 135065000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).