C28H25LiNO3P — CID 101070218
lithium 2-[methoxycarbonylimino(diphenyl)-λ5-phosphanyl]-1,2-diphenylethanolate (PubChem CID 101070218) has the molecular formula C28H25LiNO3P and a molecular weight of 461.43 g/mol. Its IUPAC name is lithium 2-[methoxycarbonylimino(diphenyl)-λ5-phosphanyl]-1,2-diphenylethanolate.
| Compound Name | lithium 2-[methoxycarbonylimino(diphenyl)-λ5-phosphanyl]-1,2-diphenylethanolate |
|---|---|
| PubChem CID | 101070218 |
| Molecular Formula | C28H25LiNO3P |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | lithium 2-[methoxycarbonylimino(diphenyl)-λ5-phosphanyl]-1,2-diphenylethanolate |
| SMILES | COC(=O)N=P(c1ccccc1)(c1ccccc1)C(c1ccccc1)C([O-])c1ccccc1.[Li+] |
| InChI | InChI=1S/C28H25NO3P.Li/c1-32-28(31)29-33(24-18-10-4-11-19-24,25-20-12-5-13-21-25)27(23-16-8-3-9-17-23)26(30)22-14-6-2-7-15-22;/h2-21,26-27H,1H3;/q-1;+1 |
| InChIKey | IYBKQMQUJBMEOL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|