C23H24NO3P — CID 101093599
methyl N-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-diphenyl-λ5-phosphanylidene]carbamate (PubChem CID 101093599) has the molecular formula C23H24NO3P and a molecular weight of 393.42 g/mol. Its IUPAC name is methyl N-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-diphenyl-λ5-phosphanylidene]carbamate.
| Compound Name | methyl N-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-diphenyl-λ5-phosphanylidene]carbamate |
|---|---|
| PubChem CID | 101093599 |
| Molecular Formula | C23H24NO3P |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | methyl N-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-diphenyl-λ5-phosphanylidene]carbamate |
| SMILES | COC(=O)N=P(c1ccccc1)(c1ccccc1)[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H24NO3P/c1-18(22(25)19-12-6-3-7-13-19)28(24-23(26)27-2,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18,22,25H,1-2H3/t18-,22-/m0/s1 |
| InChIKey | IVYKXQIGSDQHEW-AVRDEDQJSA-N |
| XLogP | 4.73 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|