C27H26NOP — CID 101362982
(1S,2R)-2-[diphenyl(phenylimino)-λ5-phosphanyl]-1-phenylpropan-1-ol (PubChem CID 101362982) has the molecular formula C27H26NOP and a molecular weight of 411.49 g/mol. Its IUPAC name is (1S,2R)-2-[diphenyl(phenylimino)-λ5-phosphanyl]-1-phenylpropan-1-ol.
| Compound Name | (1S,2R)-2-[diphenyl(phenylimino)-λ5-phosphanyl]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 101362982 |
| Molecular Formula | C27H26NOP |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (1S,2R)-2-[diphenyl(phenylimino)-λ5-phosphanyl]-1-phenylpropan-1-ol |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)P(=Nc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26NOP/c1-22(27(29)23-14-6-2-7-15-23)30(25-18-10-4-11-19-25,26-20-12-5-13-21-26)28-24-16-8-3-9-17-24/h2-22,27,29H,1H3/t22-,27-/m1/s1 |
| InChIKey | YUOIGEQKALDTJY-AJTFRIOCSA-N |
| XLogP | 6.29 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|