C17H21N2O2P — CID 135086992
methyl N-[diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate (PubChem CID 135086992) has the molecular formula C17H21N2O2P and a molecular weight of 316.34 g/mol. Its IUPAC name is methyl N-[diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate.
| Compound Name | methyl N-[diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate |
|---|---|
| PubChem CID | 135086992 |
| Molecular Formula | C17H21N2O2P |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | methyl N-[diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]carbamate |
| SMILES | COC(=O)N=P(NC(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21N2O2P/c1-14(2)18-22(19-17(20)21-3,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-14,18H,1-3H3 |
| InChIKey | NFDNVAORYQLNCE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|