About [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide
[diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide (PubChem CID 139174386) has the molecular formula C18H26BrN2P
and a molecular weight of 381.30 g/mol. Its IUPAC name is [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide.
Molecular Properties
| Compound Name | [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide |
| PubChem CID | 139174386 |
| Molecular Formula | C18H26BrN2P |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide |
| SMILES | CC(C)NP(=[NH+]C(C)C)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C18H25N2P.BrH/c1-15(2)19-21(20-16(3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-16H,1-4H3,(H,19,20);1H |
| InChIKey | KDMWDXDBOWDPGD-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide?
The IUPAC name of [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide (CID 139174386) is [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide.
What is the SMILES notation for [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide?
The canonical SMILES for [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide is CC(C)NP(=[NH+]C(C)C)(c1ccccc1)c1ccccc1.[Br-].
What is the InChIKey of [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide?
The InChIKey is KDMWDXDBOWDPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N2P.BrH/c1-15(2)19-21(20-16(3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-16H,1-4H3,(H,19,20);1H.
What are the key properties of [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide?
[diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide has a molecular weight of 381.30 g/mol, XLogP of -0.76, 5 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [diphenyl-(propan-2-ylamino)-λ5-phosphanylidene]-propan-2-ylazanium bromide is sourced from PubChem (CID 139174386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).