About cyclohexanamine;2-diphenylphosphanylacetic acid
cyclohexanamine;2-diphenylphosphanylacetic acid (PubChem CID 17389376) has the molecular formula C20H26NO2P
and a molecular weight of 343.41 g/mol. Its IUPAC name is cyclohexanamine;2-diphenylphosphanylacetic acid.
Molecular Properties
| Compound Name | cyclohexanamine;2-diphenylphosphanylacetic acid |
| PubChem CID | 17389376 |
| Molecular Formula | C20H26NO2P |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | cyclohexanamine;2-diphenylphosphanylacetic acid |
| SMILES | NC1CCCCC1.O=C(O)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13O2P.C6H13N/c15-14(16)11-17(12-7-3-1-4-8-12)13-9-5-2-6-10-13;7-6-4-2-1-3-5-6/h1-10H,11H2,(H,15,16);6H,1-5,7H2 |
| InChIKey | OLHMZQGZFVDWIF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanamine;2-diphenylphosphanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;2-diphenylphosphanylacetic acid?
The IUPAC name of cyclohexanamine;2-diphenylphosphanylacetic acid (CID 17389376) is cyclohexanamine;2-diphenylphosphanylacetic acid.
What is the SMILES notation for cyclohexanamine;2-diphenylphosphanylacetic acid?
The canonical SMILES for cyclohexanamine;2-diphenylphosphanylacetic acid is NC1CCCCC1.O=C(O)CP(c1ccccc1)c1ccccc1.
What is the InChIKey of cyclohexanamine;2-diphenylphosphanylacetic acid?
The InChIKey is OLHMZQGZFVDWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13O2P.C6H13N/c15-14(16)11-17(12-7-3-1-4-8-12)13-9-5-2-6-10-13;7-6-4-2-1-3-5-6/h1-10H,11H2,(H,15,16);6H,1-5,7H2.
What are the key properties of cyclohexanamine;2-diphenylphosphanylacetic acid?
cyclohexanamine;2-diphenylphosphanylacetic acid has a molecular weight of 343.41 g/mol, XLogP of 3.48, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;2-diphenylphosphanylacetic acid is sourced from PubChem (CID 17389376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).