C25H27F3NO2P — CID 171931627
3-(dimethylamino)propyl-triphenylphosphanium;2,2,2-trifluoroacetate (PubChem CID 171931627) has the molecular formula C25H27F3NO2P and a molecular weight of 461.46 g/mol. Its IUPAC name is 3-(dimethylamino)propyl-triphenylphosphanium;2,2,2-trifluoroacetate.
| Compound Name | 3-(dimethylamino)propyl-triphenylphosphanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 171931627 |
| Molecular Formula | C25H27F3NO2P |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 3-(dimethylamino)propyl-triphenylphosphanium;2,2,2-trifluoroacetate |
| SMILES | CN(C)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H27NP.C2HF3O2/c1-24(2)19-12-20-25(21-13-6-3-7-14-21,22-15-8-4-9-16-22)23-17-10-5-11-18-23;3-2(4,5)1(6)7/h3-11,13-18H,12,19-20H2,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | DJLSEHWJQAUXON-UHFFFAOYSA-M |
| XLogP | 3.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|